About 15-methyl-N,N-bis[4-(pentanoylamino)butyl]hexadec-6-enamide
15-methyl-N,N-bis[4-(pentanoylamino)butyl]hexadec-6-enamide (PubChem CID 162924775) has the molecular formula C35H67N3O3
and a molecular weight of 577.94 g/mol. Its IUPAC name is 15-methyl-N,N-bis[4-(pentanoylamino)butyl]hexadec-6-enamide.
Molecular Properties
| Compound Name | 15-methyl-N,N-bis[4-(pentanoylamino)butyl]hexadec-6-enamide |
| PubChem CID | 162924775 |
| Molecular Formula | C35H67N3O3 |
| Molecular Weight | 577.94 g/mol |
| Exact Mass | 577.52 |
| IUPAC Name | 15-methyl-N,N-bis[4-(pentanoylamino)butyl]hexadec-6-enamide |
| SMILES | CCCCC(=O)NCCCCN(CCCCNC(=O)CCCC)C(=O)CCCCC=CCCCCCCCC(C)C |
| InChI | InChI=1S/C35H67N3O3/c1-5-7-25-33(39)36-28-20-22-30-38(31-23-21-29-37-34(40)26-8-6-2)35(41)27-19-17-15-13-11-9-10-12-14-16-18-24-32(3)4/h11,13,32H,5-10,12,14-31H2,1-4H3,(H,36,39)(H,37,40) |
| InChIKey | CJJUXKQCHUTWFT-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 577.94 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 15-methyl-N,N-bis[4-(pentanoylamino)butyl]hexadec-6-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 15-methyl-N,N-bis[4-(pentanoylamino)butyl]hexadec-6-enamide?
The IUPAC name of 15-methyl-N,N-bis[4-(pentanoylamino)butyl]hexadec-6-enamide (CID 162924775) is 15-methyl-N,N-bis[4-(pentanoylamino)butyl]hexadec-6-enamide.
What is the SMILES notation for 15-methyl-N,N-bis[4-(pentanoylamino)butyl]hexadec-6-enamide?
The canonical SMILES for 15-methyl-N,N-bis[4-(pentanoylamino)butyl]hexadec-6-enamide is CCCCC(=O)NCCCCN(CCCCNC(=O)CCCC)C(=O)CCCCC=CCCCCCCCC(C)C.
What is the InChIKey of 15-methyl-N,N-bis[4-(pentanoylamino)butyl]hexadec-6-enamide?
The InChIKey is CJJUXKQCHUTWFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H67N3O3/c1-5-7-25-33(39)36-28-20-22-30-38(31-23-21-29-37-34(40)26-8-6-2)35(41)27-19-17-15-13-11-9-10-12-14-16-18-24-32(3)4/h11,13,32H,5-10,12,14-31H2,1-4H3,(H,36,39)(H,37,40).
What are the key properties of 15-methyl-N,N-bis[4-(pentanoylamino)butyl]hexadec-6-enamide?
15-methyl-N,N-bis[4-(pentanoylamino)butyl]hexadec-6-enamide has a molecular weight of 577.94 g/mol, XLogP of 8.49, 29 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 15-methyl-N,N-bis[4-(pentanoylamino)butyl]hexadec-6-enamide is sourced from PubChem (CID 162924775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).