C28H44O2 — CID 162924785
3-[[3-(1,5-dimethylcyclohex-2-en-1-yl)cyclohexyl]methyl]-5-(1-hydroxyheptan-2-yl)phenol (PubChem CID 162924785) has the molecular formula C28H44O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is 3-[[3-(1,5-dimethylcyclohex-2-en-1-yl)cyclohexyl]methyl]-5-(1-hydroxyheptan-2-yl)phenol.
| Compound Name | 3-[[3-(1,5-dimethylcyclohex-2-en-1-yl)cyclohexyl]methyl]-5-(1-hydroxyheptan-2-yl)phenol |
|---|---|
| PubChem CID | 162924785 |
| Molecular Formula | C28H44O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | 3-[[3-(1,5-dimethylcyclohex-2-en-1-yl)cyclohexyl]methyl]-5-(1-hydroxyheptan-2-yl)phenol |
| SMILES | CCCCCC(CO)c1cc(O)cc(CC2CCCC(C3(C)C=CCC(C)C3)C2)c1 |
| InChI | InChI=1S/C28H44O2/c1-4-5-6-11-24(20-29)25-15-23(17-27(30)18-25)14-22-10-7-12-26(16-22)28(3)13-8-9-21(2)19-28/h8,13,15,17-18,21-22,24,26,29-30H,4-7,9-12,14,16,19-20H2,1-3H3 |
| InChIKey | KRNHLAGJQXRKBU-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|