C20H36O2 — CID 162924789
(2S)-2-[2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]butane-1,4-diol (PubChem CID 162924789) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is (2S)-2-[2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]butane-1,4-diol.
| Compound Name | (2S)-2-[2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]butane-1,4-diol |
|---|---|
| PubChem CID | 162924789 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | (2S)-2-[2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]butane-1,4-diol |
| SMILES | CC1=CCC[C@@H]2[C@@](C)(CCC(CO)CCO)[C@H](C)CC[C@@]12C |
| InChI | InChI=1S/C20H36O2/c1-15-6-5-7-18-19(15,3)11-8-16(2)20(18,4)12-9-17(14-22)10-13-21/h6,16-18,21-22H,5,7-14H2,1-4H3/t16-,17?,18+,19+,20+/m1/s1 |
| InChIKey | IFRHJXBCGOZJFV-IRIKSLSWSA-N |
| XLogP | 4.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|