C22H23NO8 — CID 162925306
(1R,2R,5S,7S,9S,13R)-2-benzoyl-9-ethyl-1-hydroxy-2-methoxy-13-methyl-6,8-dioxa-3-azadispiro[4.1.57.25]tetradec-10-ene-4,12,14-trione (PubChem CID 162925306) has the molecular formula C22H23NO8 and a molecular weight of 429.43 g/mol. Its IUPAC name is (1R,2R,5S,7S,9S,13R)-2-benzoyl-9-ethyl-1-hydroxy-2-methoxy-13-methyl-6,8-dioxa-3-azadispiro[4.1.57.25]tetradec-10-ene-4,12,14-trione.
| Compound Name | (1R,2R,5S,7S,9S,13R)-2-benzoyl-9-ethyl-1-hydroxy-2-methoxy-13-methyl-6,8-dioxa-3-azadispiro[4.1.57.25]tetradec-10-ene-4,12,14-trione |
|---|---|
| PubChem CID | 162925306 |
| Molecular Formula | C22H23NO8 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | (1R,2R,5S,7S,9S,13R)-2-benzoyl-9-ethyl-1-hydroxy-2-methoxy-13-methyl-6,8-dioxa-3-azadispiro[4.1.57.25]tetradec-10-ene-4,12,14-trione |
| SMILES | CC[C@H]1C=CC(=O)[C@@]2(O1)O[C@]1(C(=O)N[C@](OC)(C(=O)c3ccccc3)[C@@H]1O)C(=O)[C@H]2C |
| InChI | InChI=1S/C22H23NO8/c1-4-14-10-11-15(24)22(30-14)12(2)16(25)20(31-22)18(27)21(29-3,23-19(20)28)17(26)13-8-6-5-7-9-13/h5-12,14,18,27H,4H2,1-3H3,(H,23,28)/t12-,14+,18-,20-,21+,22+/m1/s1 |
| InChIKey | CNNROGBXIMCNSZ-QQDHUMKUSA-N |
| XLogP | 0.31 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|