About N-(2-methylpropyl)dec-2-en-4,6,8-triynamide
N-(2-methylpropyl)dec-2-en-4,6,8-triynamide (PubChem CID 162925459) has the molecular formula C14H15NO
and a molecular weight of 213.28 g/mol. Its IUPAC name is N-(2-methylpropyl)dec-2-en-4,6,8-triynamide.
Molecular Properties
| Compound Name | N-(2-methylpropyl)dec-2-en-4,6,8-triynamide |
| PubChem CID | 162925459 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | N-(2-methylpropyl)dec-2-en-4,6,8-triynamide |
| SMILES | CC#CC#CC#CC=CC(=O)NCC(C)C |
| InChI | InChI=1S/C14H15NO/c1-4-5-6-7-8-9-10-11-14(16)15-12-13(2)3/h10-11,13H,12H2,1-3H3,(H,15,16) |
| InChIKey | CLOIUPDCVZLNQJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methylpropyl)dec-2-en-4,6,8-triynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylpropyl)dec-2-en-4,6,8-triynamide?
The IUPAC name of N-(2-methylpropyl)dec-2-en-4,6,8-triynamide (CID 162925459) is N-(2-methylpropyl)dec-2-en-4,6,8-triynamide.
What is the SMILES notation for N-(2-methylpropyl)dec-2-en-4,6,8-triynamide?
The canonical SMILES for N-(2-methylpropyl)dec-2-en-4,6,8-triynamide is CC#CC#CC#CC=CC(=O)NCC(C)C.
What is the InChIKey of N-(2-methylpropyl)dec-2-en-4,6,8-triynamide?
The InChIKey is CLOIUPDCVZLNQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO/c1-4-5-6-7-8-9-10-11-14(16)15-12-13(2)3/h10-11,13H,12H2,1-3H3,(H,15,16).
What are the key properties of N-(2-methylpropyl)dec-2-en-4,6,8-triynamide?
N-(2-methylpropyl)dec-2-en-4,6,8-triynamide has a molecular weight of 213.28 g/mol, XLogP of 1.34, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylpropyl)dec-2-en-4,6,8-triynamide is sourced from PubChem (CID 162925459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).