C13H14N2 — CID 162925977
(4aS,9aR)-1-ethyl-9,9a-dihydro-4aH-pyrido[3,4-b]indole (PubChem CID 162925977) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is (4aS,9aR)-1-ethyl-9,9a-dihydro-4aH-pyrido[3,4-b]indole.
| Compound Name | (4aS,9aR)-1-ethyl-9,9a-dihydro-4aH-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 162925977 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | (4aS,9aR)-1-ethyl-9,9a-dihydro-4aH-pyrido[3,4-b]indole |
| SMILES | CCC1=NC=C[C@H]2c3ccccc3N[C@@H]12 |
| InChI | InChI=1S/C13H14N2/c1-2-11-13-10(7-8-14-11)9-5-3-4-6-12(9)15-13/h3-8,10,13,15H,2H2,1H3/t10-,13+/m0/s1 |
| InChIKey | JQCCOYPIJNWHDP-GXFFZTMASA-N |
| XLogP | 2.94 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |