C35H41NO7 — CID 162926117
[(1R,2S)-2-[2-[(cyclohexylmethylamino)methyl]-4-hydroxy-5-methoxyphenyl]-7-hydroxy-9-methoxy-1,2,4,5-tetrahydronaphtho[1,2-g][1]benzofuran-1-yl]methyl acetate (PubChem CID 162926117) has the molecular formula C35H41NO7 and a molecular weight of 587.71 g/mol. Its IUPAC name is [(1R,2S)-2-[2-[(cyclohexylmethylamino)methyl]-4-hydroxy-5-methoxyphenyl]-7-hydroxy-9-methoxy-1,2,4,5-tetrahydronaphtho[1,2-g][1]benzofuran-1-yl]methyl acetate.
| Compound Name | [(1R,2S)-2-[2-[(cyclohexylmethylamino)methyl]-4-hydroxy-5-methoxyphenyl]-7-hydroxy-9-methoxy-1,2,4,5-tetrahydronaphtho[1,2-g][1]benzofuran-1-yl]methyl acetate |
|---|---|
| PubChem CID | 162926117 |
| Molecular Formula | C35H41NO7 |
| Molecular Weight | 587.71 g/mol |
| Exact Mass | 587.29 |
| IUPAC Name | [(1R,2S)-2-[2-[(cyclohexylmethylamino)methyl]-4-hydroxy-5-methoxyphenyl]-7-hydroxy-9-methoxy-1,2,4,5-tetrahydronaphtho[1,2-g][1]benzofuran-1-yl]methyl acetate |
| SMILES | COc1cc([C@H]2Oc3c(ccc4c3CCc3cc(O)cc(OC)c3-4)[C@@H]2COC(C)=O)c(CNCC2CCCCC2)cc1O |
| InChI | InChI=1S/C35H41NO7/c1-20(37)42-19-29-27-12-11-25-26(10-9-22-13-24(38)15-32(41-3)33(22)25)34(27)43-35(29)28-16-31(40-2)30(39)14-23(28)18-36-17-21-7-5-4-6-8-21/h11-16,21,29,35-36,38-39H,4-10,17-19H2,1-3H3/t29-,35+/m0/s1 |
| InChIKey | HIYCDYKYUAKJCK-WHMAPKLYSA-N |
| XLogP | 6.33 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.71 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |