C13H18O3 — CID 162926559
(2Z,3R,4S,5R)-2-but-2-ynylidene-6-oxaspiro[4.5]decane-3,4-diol (PubChem CID 162926559) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (2Z,3R,4S,5R)-2-but-2-ynylidene-6-oxaspiro[4.5]decane-3,4-diol.
| Compound Name | (2Z,3R,4S,5R)-2-but-2-ynylidene-6-oxaspiro[4.5]decane-3,4-diol |
|---|---|
| PubChem CID | 162926559 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (2Z,3R,4S,5R)-2-but-2-ynylidene-6-oxaspiro[4.5]decane-3,4-diol |
| SMILES | CC#C/C=C1/C[C@]2(CCCCO2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H18O3/c1-2-3-6-10-9-13(12(15)11(10)14)7-4-5-8-16-13/h6,11-12,14-15H,4-5,7-9H2,1H3/b10-6-/t11-,12+,13-/m1/s1 |
| InChIKey | RZEXIMRXKVYRLP-YRHGKNAFSA-N |
| XLogP | 1.00 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|