C30H41NO6 — CID 162926724
3-[5-hydroxy-5-[2-hydroxy-11-(2-hydroxyethyl)-3-methoxy-7-oxo-9,10-didehydro-5,6,8,11-tetrahydrobenzo[9]annulen-8-yl]pentyl]-2,3,4,4a,5,6,8,8a-octahydro-1H-quinolin-7-one (PubChem CID 162926724) has the molecular formula C30H41NO6 and a molecular weight of 511.66 g/mol. Its IUPAC name is 3-[5-hydroxy-5-[2-hydroxy-11-(2-hydroxyethyl)-3-methoxy-7-oxo-9,10-didehydro-5,6,8,11-tetrahydrobenzo[9]annulen-8-yl]pentyl]-2,3,4,4a,5,6,8,8a-octahydro-1H-quinolin-7-one.
| Compound Name | 3-[5-hydroxy-5-[2-hydroxy-11-(2-hydroxyethyl)-3-methoxy-7-oxo-9,10-didehydro-5,6,8,11-tetrahydrobenzo[9]annulen-8-yl]pentyl]-2,3,4,4a,5,6,8,8a-octahydro-1H-quinolin-7-one |
|---|---|
| PubChem CID | 162926724 |
| Molecular Formula | C30H41NO6 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | 3-[5-hydroxy-5-[2-hydroxy-11-(2-hydroxyethyl)-3-methoxy-7-oxo-9,10-didehydro-5,6,8,11-tetrahydrobenzo[9]annulen-8-yl]pentyl]-2,3,4,4a,5,6,8,8a-octahydro-1H-quinolin-7-one |
| SMILES | COc1cc2c(cc1O)C(CCO)C#CC(C(O)CCCCC1CNC3CC(=O)CCC3C1)C(=O)CC2 |
| InChI | InChI=1S/C30H41NO6/c1-37-30-15-21-8-11-28(35)24(10-7-20(12-13-32)25(21)17-29(30)36)27(34)5-3-2-4-19-14-22-6-9-23(33)16-26(22)31-18-19/h15,17,19-20,22,24,26-27,31-32,34,36H,2-6,8-9,11-14,16,18H2,1H3 |
| InChIKey | HWORVPCLZXNDJU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|