C21H30O5 — CID 162926837
(2S,5E)-2-[3-(furan-3-yl)propyl]-6-methoxycarbonyl-10-methylundeca-5,9-dienoic acid (PubChem CID 162926837) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is (2S,5E)-2-[3-(furan-3-yl)propyl]-6-methoxycarbonyl-10-methylundeca-5,9-dienoic acid.
| Compound Name | (2S,5E)-2-[3-(furan-3-yl)propyl]-6-methoxycarbonyl-10-methylundeca-5,9-dienoic acid |
|---|---|
| PubChem CID | 162926837 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (2S,5E)-2-[3-(furan-3-yl)propyl]-6-methoxycarbonyl-10-methylundeca-5,9-dienoic acid |
| SMILES | COC(=O)/C(=C/CC[C@H](CCCc1ccoc1)C(=O)O)CCC=C(C)C |
| InChI | InChI=1S/C21H30O5/c1-16(2)7-4-11-19(21(24)25-3)12-6-10-18(20(22)23)9-5-8-17-13-14-26-15-17/h7,12-15,18H,4-6,8-11H2,1-3H3,(H,22,23)/b19-12+/t18-/m0/s1 |
| InChIKey | HXALOZYLMZYNEY-LPGQDOADSA-N |
| XLogP | 4.93 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|