C30H52 — CID 162926942
(6E,10E,13E,14R)-2,6,10,14,18-pentamethyl-13-[(3R)-3-methylpent-4-enylidene]nonadeca-2,6,10-triene (PubChem CID 162926942) has the molecular formula C30H52 and a molecular weight of 412.75 g/mol. Its IUPAC name is (6E,10E,13E,14R)-2,6,10,14,18-pentamethyl-13-[(3R)-3-methylpent-4-enylidene]nonadeca-2,6,10-triene.
| Compound Name | (6E,10E,13E,14R)-2,6,10,14,18-pentamethyl-13-[(3R)-3-methylpent-4-enylidene]nonadeca-2,6,10-triene |
|---|---|
| PubChem CID | 162926942 |
| Molecular Formula | C30H52 |
| Molecular Weight | 412.75 g/mol |
| Exact Mass | 412.41 |
| IUPAC Name | (6E,10E,13E,14R)-2,6,10,14,18-pentamethyl-13-[(3R)-3-methylpent-4-enylidene]nonadeca-2,6,10-triene |
| SMILES | C=C[C@H](C)C/C=C(\C/C=C(\C)CC/C=C(\C)CCC=C(C)C)[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C30H52/c1-10-26(6)20-22-30(29(9)19-12-15-25(4)5)23-21-28(8)18-13-17-27(7)16-11-14-24(2)3/h10,14,17,21-22,25-26,29H,1,11-13,15-16,18-20,23H2,2-9H3/b27-17+,28-21+,30-22+/t26-,29+/m0/s1 |
| InChIKey | BNYPZWFLESHHNE-OGKJOVLOSA-N |
| XLogP | 10.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.75 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|