C21H28O4 — CID 162927021
15-acetyl-6-hydroxy-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-4-en-3-one (PubChem CID 162927021) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is 15-acetyl-6-hydroxy-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-4-en-3-one.
| Compound Name | 15-acetyl-6-hydroxy-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-4-en-3-one |
|---|---|
| PubChem CID | 162927021 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 15-acetyl-6-hydroxy-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-4-en-3-one |
| SMILES | CC(=O)C1CCC2C3CC4OC45C(O)C=CC(=O)C5(C)C3CCC12C |
| InChI | InChI=1S/C21H28O4/c1-11(22)13-4-5-14-12-10-18-21(25-18)17(24)7-6-16(23)20(21,3)15(12)8-9-19(13,14)2/h6-7,12-15,17-18,24H,4-5,8-10H2,1-3H3 |
| InChIKey | SURXHIGMEGUSHR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|