C37H52N2O10 — CID 162927475
(11-ethyl-8,9-dihydroxy-4,16,18-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-13-yl)methyl 2-[(4-methoxy-3-methyl-4-oxobutanoyl)amino]benzoate (PubChem CID 162927475) has the molecular formula C37H52N2O10 and a molecular weight of 684.83 g/mol. Its IUPAC name is (11-ethyl-8,9-dihydroxy-4,16,18-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-13-yl)methyl 2-[(4-methoxy-3-methyl-4-oxobutanoyl)amino]benzoate.
| Compound Name | (11-ethyl-8,9-dihydroxy-4,16,18-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-13-yl)methyl 2-[(4-methoxy-3-methyl-4-oxobutanoyl)amino]benzoate |
|---|---|
| PubChem CID | 162927475 |
| Molecular Formula | C37H52N2O10 |
| Molecular Weight | 684.83 g/mol |
| Exact Mass | 684.36 |
| IUPAC Name | (11-ethyl-8,9-dihydroxy-4,16,18-trimethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-13-yl)methyl 2-[(4-methoxy-3-methyl-4-oxobutanoyl)amino]benzoate |
| SMILES | CCN1CC2(COC(=O)c3ccccc3NC(=O)CC(C)C(=O)OC)CCC(OC)C34C5CC6CCC(O)(C5C6OC)C(O)(C(OC)C23)C14 |
| InChI | InChI=1S/C37H52N2O10/c1-7-39-18-34(19-49-32(42)22-10-8-9-11-24(22)38-26(40)16-20(2)31(41)48-6)14-13-25(45-3)36-23-17-21-12-15-35(43,27(23)28(21)46-4)37(44,33(36)39)30(47-5)29(34)36/h8-11,20-21,23,25,27-30,33,43-44H,7,12-19H2,1-6H3,(H,38,40) |
| InChIKey | PQUGXRLCDABVSU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 153.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.83 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |