C15H24O — CID 162927488
(3S,3aS,6S,9aR)-3,5,6-trimethyl-9-methylidene-2,3a,6,7,8,9a-hexahydro-1H-cyclopenta[8]annulen-3-ol (PubChem CID 162927488) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (3S,3aS,6S,9aR)-3,5,6-trimethyl-9-methylidene-2,3a,6,7,8,9a-hexahydro-1H-cyclopenta[8]annulen-3-ol.
| Compound Name | (3S,3aS,6S,9aR)-3,5,6-trimethyl-9-methylidene-2,3a,6,7,8,9a-hexahydro-1H-cyclopenta[8]annulen-3-ol |
|---|---|
| PubChem CID | 162927488 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (3S,3aS,6S,9aR)-3,5,6-trimethyl-9-methylidene-2,3a,6,7,8,9a-hexahydro-1H-cyclopenta[8]annulen-3-ol |
| SMILES | C=C1CC[C@H](C)C(C)=C[C@H]2[C@H]1CC[C@]2(C)O |
| InChI | InChI=1S/C15H24O/c1-10-5-6-11(2)13-7-8-15(4,16)14(13)9-12(10)3/h9-10,13-14,16H,2,5-8H2,1,3-4H3/t10-,13-,14-,15-/m0/s1 |
| InChIKey | LMBNOBPWWFAPHY-HJPIBITLSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|