C10H16Br2O2 — CID 162928061
(E,2R)-4-bromo-2-[(2S,4R)-4-bromo-5,5-dimethyloxolan-2-yl]but-3-en-2-ol (PubChem CID 162928061) has the molecular formula C10H16Br2O2 and a molecular weight of 328.04 g/mol. Its IUPAC name is (E,2R)-4-bromo-2-[(2S,4R)-4-bromo-5,5-dimethyloxolan-2-yl]but-3-en-2-ol.
| Compound Name | (E,2R)-4-bromo-2-[(2S,4R)-4-bromo-5,5-dimethyloxolan-2-yl]but-3-en-2-ol |
|---|---|
| PubChem CID | 162928061 |
| Molecular Formula | C10H16Br2O2 |
| Molecular Weight | 328.04 g/mol |
| Exact Mass | 325.95 |
| IUPAC Name | (E,2R)-4-bromo-2-[(2S,4R)-4-bromo-5,5-dimethyloxolan-2-yl]but-3-en-2-ol |
| SMILES | CC1(C)O[C@H]([C@](C)(O)/C=C/Br)C[C@H]1Br |
| InChI | InChI=1S/C10H16Br2O2/c1-9(2)7(12)6-8(14-9)10(3,13)4-5-11/h4-5,7-8,13H,6H2,1-3H3/b5-4+/t7-,8+,10-/m1/s1 |
| InChIKey | UIVSTSHQZIFSSM-WFWWRNNBSA-N |
| XLogP | 2.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.04 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|