C19H22O4 — CID 162928103
(1S,2S,3R,7R,9R,10R,14R)-14-ethenyl-6-ethylidene-1,9,10-trimethyl-4,8-dioxatetracyclo[8.3.1.02,9.03,7]tetradec-12-ene-5,11-dione (PubChem CID 162928103) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is (1S,2S,3R,7R,9R,10R,14R)-14-ethenyl-6-ethylidene-1,9,10-trimethyl-4,8-dioxatetracyclo[8.3.1.02,9.03,7]tetradec-12-ene-5,11-dione.
| Compound Name | (1S,2S,3R,7R,9R,10R,14R)-14-ethenyl-6-ethylidene-1,9,10-trimethyl-4,8-dioxatetracyclo[8.3.1.02,9.03,7]tetradec-12-ene-5,11-dione |
|---|---|
| PubChem CID | 162928103 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (1S,2S,3R,7R,9R,10R,14R)-14-ethenyl-6-ethylidene-1,9,10-trimethyl-4,8-dioxatetracyclo[8.3.1.02,9.03,7]tetradec-12-ene-5,11-dione |
| SMILES | C=C[C@@H]1[C@]2(C)C=CC(=O)[C@@]1(C)[C@]1(C)O[C@@H]3C(=CC)C(=O)O[C@@H]3[C@H]21 |
| InChI | InChI=1S/C19H22O4/c1-6-10-13-14(22-16(10)21)15-17(3)9-8-12(20)18(4,11(17)7-2)19(15,5)23-13/h6-9,11,13-15H,2H2,1,3-5H3/t11-,13-,14+,15-,17+,18+,19-/m1/s1 |
| InChIKey | GZIJJRCTNVDSSI-PLKZDPFXSA-N |
| XLogP | 2.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|