C28H24O12 — CID 162928169
[4,5-dihydroxy-2-(hydroxymethyl)-6-(1,3,6,7-tetrahydroxy-9-oxoxanthen-2-yl)oxan-3-yl] 3-phenylprop-2-enoate (PubChem CID 162928169) has the molecular formula C28H24O12 and a molecular weight of 552.49 g/mol. Its IUPAC name is [4,5-dihydroxy-2-(hydroxymethyl)-6-(1,3,6,7-tetrahydroxy-9-oxoxanthen-2-yl)oxan-3-yl] 3-phenylprop-2-enoate.
| Compound Name | [4,5-dihydroxy-2-(hydroxymethyl)-6-(1,3,6,7-tetrahydroxy-9-oxoxanthen-2-yl)oxan-3-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162928169 |
| Molecular Formula | C28H24O12 |
| Molecular Weight | 552.49 g/mol |
| Exact Mass | 552.13 |
| IUPAC Name | [4,5-dihydroxy-2-(hydroxymethyl)-6-(1,3,6,7-tetrahydroxy-9-oxoxanthen-2-yl)oxan-3-yl] 3-phenylprop-2-enoate |
| SMILES | O=C(C=Cc1ccccc1)OC1C(CO)OC(c2c(O)cc3oc4cc(O)c(O)cc4c(=O)c3c2O)C(O)C1O |
| InChI | InChI=1S/C28H24O12/c29-11-19-27(40-20(33)7-6-12-4-2-1-3-5-12)25(36)26(37)28(39-19)21-16(32)10-18-22(24(21)35)23(34)13-8-14(30)15(31)9-17(13)38-18/h1-10,19,25-32,35-37H,11H2 |
| InChIKey | GGDCQCYWAMAMQR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 207.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.49 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|