C36H60O6 — CID 162928267
2-(hydroxymethyl)-6-[[12-hydroxy-4,4,8,10,14-pentamethyl-17-(6-methylhepta-1,5-dien-2-yl)-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4-diol (PubChem CID 162928267) has the molecular formula C36H60O6 and a molecular weight of 588.87 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-[[12-hydroxy-4,4,8,10,14-pentamethyl-17-(6-methylhepta-1,5-dien-2-yl)-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4-diol.
| Compound Name | 2-(hydroxymethyl)-6-[[12-hydroxy-4,4,8,10,14-pentamethyl-17-(6-methylhepta-1,5-dien-2-yl)-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4-diol |
|---|---|
| PubChem CID | 162928267 |
| Molecular Formula | C36H60O6 |
| Molecular Weight | 588.87 g/mol |
| Exact Mass | 588.44 |
| IUPAC Name | 2-(hydroxymethyl)-6-[[12-hydroxy-4,4,8,10,14-pentamethyl-17-(6-methylhepta-1,5-dien-2-yl)-2,3,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxane-3,4-diol |
| SMILES | C=C(CCC=C(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(OC4CC(O)C(O)C(CO)O4)C(C)(C)C3CCC12C |
| InChI | InChI=1S/C36H60O6/c1-21(2)10-9-11-22(3)23-12-16-36(8)31(23)24(38)18-28-34(6)15-14-29(33(4,5)27(34)13-17-35(28,36)7)42-30-19-25(39)32(40)26(20-37)41-30/h10,23-32,37-40H,3,9,11-20H2,1-2,4-8H3 |
| InChIKey | UZRSSXUIXNCYLP-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.87 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|