C19H32N6O2 — CID 162928911
(3S,4R,6R)-N-(2-acetamidoethyl)-6-[(4-tert-butyltriazol-1-yl)methyl]-1-azabicyclo[2.2.2]octane-3-carboxamide (PubChem CID 162928911) has the molecular formula C19H32N6O2 and a molecular weight of 376.51 g/mol. Its IUPAC name is (3S,4R,6R)-N-(2-acetamidoethyl)-6-[(4-tert-butyltriazol-1-yl)methyl]-1-azabicyclo[2.2.2]octane-3-carboxamide.
| Compound Name | (3S,4R,6R)-N-(2-acetamidoethyl)-6-[(4-tert-butyltriazol-1-yl)methyl]-1-azabicyclo[2.2.2]octane-3-carboxamide |
|---|---|
| PubChem CID | 162928911 |
| Molecular Formula | C19H32N6O2 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | (3S,4R,6R)-N-(2-acetamidoethyl)-6-[(4-tert-butyltriazol-1-yl)methyl]-1-azabicyclo[2.2.2]octane-3-carboxamide |
| SMILES | CC(=O)NCCNC(=O)[C@@H]1CN2CC[C@@H]1C[C@@H]2Cn1cc(C(C)(C)C)nn1 |
| InChI | InChI=1S/C19H32N6O2/c1-13(26)20-6-7-21-18(27)16-11-24-8-5-14(16)9-15(24)10-25-12-17(22-23-25)19(2,3)4/h12,14-16H,5-11H2,1-4H3,(H,20,26)(H,21,27)/t14-,15-,16-/m1/s1 |
| InChIKey | SPBKBDMODIUIFB-BZUAXINKSA-N |
| XLogP | 0.54 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|