C80H90N2O13 — CID 162929148
CID 162929148 (PubChem CID 162929148) has the molecular formula C80H90N2O13 and a molecular weight of 1287.60 g/mol.
| Compound Name | CID 162929148 |
|---|---|
| PubChem CID | 162929148 |
| Molecular Formula | C80H90N2O13 |
| Molecular Weight | 1287.60 g/mol |
| Exact Mass | 1286.64 |
| IUPAC Name | — |
| SMILES | COc1c2c3c4c(O)c(c5c6c4c1CCC6=C[C@@H]1CCC[C@@H]51)C(=O)CN1Cc4c(cccc4C1=O)CC#CO[C@H]1[C@H](O)[C@@H](CO[C@@H](c4c[nH]c5cc6c7c(c45)C[C@@]4(C[C@H]5C[C@H]8CCC[C@@]8(O)C[C@@]75CC6)C[C@]5(CC[C@@H](CCCO)C5)CC45CCCC5)/C=C\2)O[C@H](O3)[C@@]1(O)CO |
| InChI | InChI=1S/C80H90N2O13/c1-91-70-52-17-16-46-29-45-11-5-14-50(45)63-61(46)64(52)66-69(87)65(63)58(85)37-82-36-56-44(10-4-15-51(56)73(82)88)12-8-28-92-72-68(86)60-38-93-59(19-18-53(70)71(66)95-74(94-60)80(72,90)42-84)55-35-81-57-30-47-21-26-78-41-79(89)24-6-13-48(79)31-49(78)33-77(34-54(62(55)57)67(47)78)40-75(39-76(77)22-2-3-23-76)25-20-43(32-75)9-7-27-83/h4,10,15,18-19,29-30,35,43,45,48-50,59-60,68,72,74,81,83-84,86-87,89-90H,2-3,5-7,9,11-14,16-17,20-27,31-34,36-42H2,1H3/b19-18-/t43-,45+,48-,49-,50-,59-,60-,68-,72+,74-,75+,77+,78-,79-,80-/m1/s1 |
| InChIKey | SAODLBJMFSOZQH-VWNWEIJQSA-N |
| XLogP | 11.95 |
| TPSA | 220.70 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 95 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1287.60 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|