C19H30O9 — CID 162929151
(E)-4-[(1S,3S,4R,6R)-3-hydroxy-2,2,6-trimethyl-4-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7-oxabicyclo[4.1.0]heptan-1-yl]but-3-en-2-one (PubChem CID 162929151) has the molecular formula C19H30O9 and a molecular weight of 402.44 g/mol. Its IUPAC name is (E)-4-[(1S,3S,4R,6R)-3-hydroxy-2,2,6-trimethyl-4-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7-oxabicyclo[4.1.0]heptan-1-yl]but-3-en-2-one.
| Compound Name | (E)-4-[(1S,3S,4R,6R)-3-hydroxy-2,2,6-trimethyl-4-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7-oxabicyclo[4.1.0]heptan-1-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 162929151 |
| Molecular Formula | C19H30O9 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (E)-4-[(1S,3S,4R,6R)-3-hydroxy-2,2,6-trimethyl-4-[(2R,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7-oxabicyclo[4.1.0]heptan-1-yl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/[C@@]12O[C@]1(C)C[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@@H](O)[C@H]1O)[C@@H](O)C2(C)C |
| InChI | InChI=1S/C19H30O9/c1-9(21)5-6-19-17(2,3)15(25)10(7-18(19,4)28-19)26-16-14(24)13(23)12(22)11(8-20)27-16/h5-6,10-16,20,22-25H,7-8H2,1-4H3/b6-5+/t10-,11-,12-,13-,14-,15-,16-,18-,19+/m1/s1 |
| InChIKey | FIQIJTGYCDYNPQ-JARCUUKLSA-N |
| XLogP | -1.36 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|