C24H30O5 — CID 162929416
[(1R,5S)-4,6,6-trimethyl-5-[(2-oxochromen-7-yl)oxymethyl]cyclohex-3-en-1-yl] (2R)-2-methylbutanoate (PubChem CID 162929416) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is [(1R,5S)-4,6,6-trimethyl-5-[(2-oxochromen-7-yl)oxymethyl]cyclohex-3-en-1-yl] (2R)-2-methylbutanoate.
| Compound Name | [(1R,5S)-4,6,6-trimethyl-5-[(2-oxochromen-7-yl)oxymethyl]cyclohex-3-en-1-yl] (2R)-2-methylbutanoate |
|---|---|
| PubChem CID | 162929416 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | [(1R,5S)-4,6,6-trimethyl-5-[(2-oxochromen-7-yl)oxymethyl]cyclohex-3-en-1-yl] (2R)-2-methylbutanoate |
| SMILES | CC[C@@H](C)C(=O)O[C@@H]1CC=C(C)[C@H](COc2ccc3ccc(=O)oc3c2)C1(C)C |
| InChI | InChI=1S/C24H30O5/c1-6-15(2)23(26)29-21-11-7-16(3)19(24(21,4)5)14-27-18-10-8-17-9-12-22(25)28-20(17)13-18/h7-10,12-13,15,19,21H,6,11,14H2,1-5H3/t15-,19+,21-/m1/s1 |
| InChIKey | IZBATAZTWSFDPS-MFMILTCTSA-N |
| XLogP | 5.12 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|