C29H44O3 — CID 162929420
[(1R,4aR,4bS,7S,10aS)-7-ethenyl-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-1-yl]methyl (1R,2S,5S)-2-acetyl-5-methylcyclopentane-1-carboxylate (PubChem CID 162929420) has the molecular formula C29H44O3 and a molecular weight of 440.67 g/mol. Its IUPAC name is [(1R,4aR,4bS,7S,10aS)-7-ethenyl-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-1-yl]methyl (1R,2S,5S)-2-acetyl-5-methylcyclopentane-1-carboxylate.
| Compound Name | [(1R,4aR,4bS,7S,10aS)-7-ethenyl-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-1-yl]methyl (1R,2S,5S)-2-acetyl-5-methylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 162929420 |
| Molecular Formula | C29H44O3 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | [(1R,4aR,4bS,7S,10aS)-7-ethenyl-1,4a,7-trimethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-1-yl]methyl (1R,2S,5S)-2-acetyl-5-methylcyclopentane-1-carboxylate |
| SMILES | C=C[C@@]1(C)CC[C@H]2C(=CC[C@@H]3[C@](C)(COC(=O)[C@H]4[C@@H](C(C)=O)CC[C@@H]4C)CCC[C@@]32C)C1 |
| InChI | InChI=1S/C29H44O3/c1-7-27(4)16-13-23-21(17-27)10-12-24-28(5,14-8-15-29(23,24)6)18-32-26(31)25-19(2)9-11-22(25)20(3)30/h7,10,19,22-25H,1,8-9,11-18H2,2-6H3/t19-,22+,23-,24+,25+,27-,28-,29+/m0/s1 |
| InChIKey | BACJZVCXASSNGU-PBJSNUSUSA-N |
| XLogP | 6.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|