C26H40O2 — CID 162929790
methyl (1E,5Z,9E,12R)-5,9-dimethyl-12-(6-methylhepta-1,5-dien-2-yl)cyclotetradeca-1,5,9-triene-1-carboxylate (PubChem CID 162929790) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is methyl (1E,5Z,9E,12R)-5,9-dimethyl-12-(6-methylhepta-1,5-dien-2-yl)cyclotetradeca-1,5,9-triene-1-carboxylate.
| Compound Name | methyl (1E,5Z,9E,12R)-5,9-dimethyl-12-(6-methylhepta-1,5-dien-2-yl)cyclotetradeca-1,5,9-triene-1-carboxylate |
|---|---|
| PubChem CID | 162929790 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | methyl (1E,5Z,9E,12R)-5,9-dimethyl-12-(6-methylhepta-1,5-dien-2-yl)cyclotetradeca-1,5,9-triene-1-carboxylate |
| SMILES | C=C(CCC=C(C)C)[C@H]1C/C=C(\C)CC/C=C(/C)CC/C=C(/C(=O)OC)CC1 |
| InChI | InChI=1S/C26H40O2/c1-20(2)10-7-14-23(5)24-17-16-22(4)12-8-11-21(3)13-9-15-25(19-18-24)26(27)28-6/h10-11,15-16,24H,5,7-9,12-14,17-19H2,1-4,6H3/b21-11-,22-16+,25-15+/t24-/m0/s1 |
| InChIKey | KCRZTXLUSQNUBI-OLJFVXDYSA-N |
| XLogP | 7.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|