C20H32O2 — CID 162930313
(1S,2R,5S,6E,9R,12S)-1,5,9-trimethyl-12-propan-2-yl-15,16-dioxatricyclo[7.5.1.12,5]hexadeca-6,10-diene (PubChem CID 162930313) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1S,2R,5S,6E,9R,12S)-1,5,9-trimethyl-12-propan-2-yl-15,16-dioxatricyclo[7.5.1.12,5]hexadeca-6,10-diene.
| Compound Name | (1S,2R,5S,6E,9R,12S)-1,5,9-trimethyl-12-propan-2-yl-15,16-dioxatricyclo[7.5.1.12,5]hexadeca-6,10-diene |
|---|---|
| PubChem CID | 162930313 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1S,2R,5S,6E,9R,12S)-1,5,9-trimethyl-12-propan-2-yl-15,16-dioxatricyclo[7.5.1.12,5]hexadeca-6,10-diene |
| SMILES | CC(C)[C@H]1C=C[C@@]2(C)C/C=C\[C@]3(C)CC[C@@H](O3)[C@](C)(CC1)O2 |
| InChI | InChI=1S/C20H32O2/c1-15(2)16-7-12-19(4)11-6-10-18(3)13-9-17(21-18)20(5,22-19)14-8-16/h6-7,10,12,15-17H,8-9,11,13-14H2,1-5H3/b10-6-,12-7?/t16-,17+,18+,19+,20-/m0/s1 |
| InChIKey | NZXAHQRVZURVSS-HFTYDWDGSA-N |
| XLogP | 5.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|