C21H40O4 — CID 162930736
(E,3R,4R,6R,10S)-4,6,10-triethyl-3,6-dihydroxy-8-methyltetradec-7-enoic acid (PubChem CID 162930736) has the molecular formula C21H40O4 and a molecular weight of 356.55 g/mol. Its IUPAC name is (E,3R,4R,6R,10S)-4,6,10-triethyl-3,6-dihydroxy-8-methyltetradec-7-enoic acid.
| Compound Name | (E,3R,4R,6R,10S)-4,6,10-triethyl-3,6-dihydroxy-8-methyltetradec-7-enoic acid |
|---|---|
| PubChem CID | 162930736 |
| Molecular Formula | C21H40O4 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.29 |
| IUPAC Name | (E,3R,4R,6R,10S)-4,6,10-triethyl-3,6-dihydroxy-8-methyltetradec-7-enoic acid |
| SMILES | CCCC[C@H](CC)C/C(C)=C/[C@@](O)(CC)C[C@@H](CC)[C@H](O)CC(=O)O |
| InChI | InChI=1S/C21H40O4/c1-6-10-11-17(7-2)12-16(5)14-21(25,9-4)15-18(8-3)19(22)13-20(23)24/h14,17-19,22,25H,6-13,15H2,1-5H3,(H,23,24)/b16-14+/t17-,18+,19+,21-/m0/s1 |
| InChIKey | IKTPWVGSUROYSG-PTTLPDHWSA-N |
| XLogP | 4.93 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|