About 3-hydroxy-4-methoxy-5-propan-2-ylcyclohepta-2,4,6-trien-1-one
3-hydroxy-4-methoxy-5-propan-2-ylcyclohepta-2,4,6-trien-1-one (PubChem CID 162931009) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-hydroxy-4-methoxy-5-propan-2-ylcyclohepta-2,4,6-trien-1-one.
Molecular Properties
| Compound Name | 3-hydroxy-4-methoxy-5-propan-2-ylcyclohepta-2,4,6-trien-1-one |
| PubChem CID | 162931009 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 3-hydroxy-4-methoxy-5-propan-2-ylcyclohepta-2,4,6-trien-1-one |
| SMILES | COc1c(O)cc(=O)ccc1C(C)C |
| InChI | InChI=1S/C11H14O3/c1-7(2)9-5-4-8(12)6-10(13)11(9)14-3/h4-7,13H,1-3H3 |
| InChIKey | SDUZOVSWFAXQBA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-hydroxy-4-methoxy-5-propan-2-ylcyclohepta-2,4,6-trien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-4-methoxy-5-propan-2-ylcyclohepta-2,4,6-trien-1-one?
The IUPAC name of 3-hydroxy-4-methoxy-5-propan-2-ylcyclohepta-2,4,6-trien-1-one (CID 162931009) is 3-hydroxy-4-methoxy-5-propan-2-ylcyclohepta-2,4,6-trien-1-one.
What is the SMILES notation for 3-hydroxy-4-methoxy-5-propan-2-ylcyclohepta-2,4,6-trien-1-one?
The canonical SMILES for 3-hydroxy-4-methoxy-5-propan-2-ylcyclohepta-2,4,6-trien-1-one is COc1c(O)cc(=O)ccc1C(C)C.
What is the InChIKey of 3-hydroxy-4-methoxy-5-propan-2-ylcyclohepta-2,4,6-trien-1-one?
The InChIKey is SDUZOVSWFAXQBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-7(2)9-5-4-8(12)6-10(13)11(9)14-3/h4-7,13H,1-3H3.
What are the key properties of 3-hydroxy-4-methoxy-5-propan-2-ylcyclohepta-2,4,6-trien-1-one?
3-hydroxy-4-methoxy-5-propan-2-ylcyclohepta-2,4,6-trien-1-one has a molecular weight of 194.23 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-4-methoxy-5-propan-2-ylcyclohepta-2,4,6-trien-1-one is sourced from PubChem (CID 162931009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).