C27H38O7 — CID 162931236
[(2Z,6E,8S,10E)-8-acetyloxy-10-[(4S,5R)-4-hydroxy-5-(2-methylprop-1-enyl)-2-oxooxolan-3-ylidene]-3,7-dimethyldeca-2,6-dienyl] (Z)-2-methylbut-2-enoate (PubChem CID 162931236) has the molecular formula C27H38O7 and a molecular weight of 474.59 g/mol. Its IUPAC name is [(2Z,6E,8S,10E)-8-acetyloxy-10-[(4S,5R)-4-hydroxy-5-(2-methylprop-1-enyl)-2-oxooxolan-3-ylidene]-3,7-dimethyldeca-2,6-dienyl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(2Z,6E,8S,10E)-8-acetyloxy-10-[(4S,5R)-4-hydroxy-5-(2-methylprop-1-enyl)-2-oxooxolan-3-ylidene]-3,7-dimethyldeca-2,6-dienyl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162931236 |
| Molecular Formula | C27H38O7 |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | [(2Z,6E,8S,10E)-8-acetyloxy-10-[(4S,5R)-4-hydroxy-5-(2-methylprop-1-enyl)-2-oxooxolan-3-ylidene]-3,7-dimethyldeca-2,6-dienyl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)OC/C=C(/C)CC/C=C(\C)[C@H](C/C=C1/C(=O)O[C@H](C=C(C)C)[C@H]1O)OC(C)=O |
| InChI | InChI=1S/C27H38O7/c1-8-19(5)26(30)32-15-14-18(4)10-9-11-20(6)23(33-21(7)28)13-12-22-25(29)24(16-17(2)3)34-27(22)31/h8,11-12,14,16,23-25,29H,9-10,13,15H2,1-7H3/b18-14-,19-8-,20-11+,22-12+/t23-,24+,25-/m0/s1 |
| InChIKey | HHTIRRPXBFOLAU-DNHWIGEVSA-N |
| XLogP | 4.67 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|