C18H34O2 — CID 162931464
(E,6R,14S)-14-hydroxy-2,6,10-trimethylpentadec-10-en-4-one (PubChem CID 162931464) has the molecular formula C18H34O2 and a molecular weight of 282.47 g/mol. Its IUPAC name is (E,6R,14S)-14-hydroxy-2,6,10-trimethylpentadec-10-en-4-one.
| Compound Name | (E,6R,14S)-14-hydroxy-2,6,10-trimethylpentadec-10-en-4-one |
|---|---|
| PubChem CID | 162931464 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | (E,6R,14S)-14-hydroxy-2,6,10-trimethylpentadec-10-en-4-one |
| SMILES | C/C(=C\CC[C@H](C)O)CCC[C@@H](C)CC(=O)CC(C)C |
| InChI | InChI=1S/C18H34O2/c1-14(2)12-18(20)13-16(4)10-6-8-15(3)9-7-11-17(5)19/h9,14,16-17,19H,6-8,10-13H2,1-5H3/b15-9+/t16-,17+/m1/s1 |
| InChIKey | GDRMRPKWVXLGBG-PETGEZQVSA-N |
| XLogP | 4.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|