C20H20O11 — CID 162931679
2-(2,3-dihydroxyphenyl)-5,7-dihydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxy-2,3-dihydrochromen-4-one (PubChem CID 162931679) has the molecular formula C20H20O11 and a molecular weight of 436.37 g/mol. Its IUPAC name is 2-(2,3-dihydroxyphenyl)-5,7-dihydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxy-2,3-dihydrochromen-4-one.
| Compound Name | 2-(2,3-dihydroxyphenyl)-5,7-dihydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 162931679 |
| Molecular Formula | C20H20O11 |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 2-(2,3-dihydroxyphenyl)-5,7-dihydroxy-3-(3,4,5-trihydroxyoxan-2-yl)oxy-2,3-dihydrochromen-4-one |
| SMILES | O=C1c2c(O)cc(O)cc2OC(c2cccc(O)c2O)C1OC1OCC(O)C(O)C1O |
| InChI | InChI=1S/C20H20O11/c21-7-4-10(23)13-12(5-7)30-18(8-2-1-3-9(22)14(8)25)19(16(13)27)31-20-17(28)15(26)11(24)6-29-20/h1-5,11,15,17-26,28H,6H2 |
| InChIKey | URQAKMMYHQWCKC-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 186.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|