C27H36O6 — CID 162931870
[(1Z,3R,4E,8E)-4,8-dimethyl-1-[(5R)-5-(2-methylprop-1-enyl)-2-oxooxolan-3-ylidene]-11-(5-oxo-2H-furan-3-yl)undeca-4,8-dien-3-yl] acetate (PubChem CID 162931870) has the molecular formula C27H36O6 and a molecular weight of 456.58 g/mol. Its IUPAC name is [(1Z,3R,4E,8E)-4,8-dimethyl-1-[(5R)-5-(2-methylprop-1-enyl)-2-oxooxolan-3-ylidene]-11-(5-oxo-2H-furan-3-yl)undeca-4,8-dien-3-yl] acetate.
| Compound Name | [(1Z,3R,4E,8E)-4,8-dimethyl-1-[(5R)-5-(2-methylprop-1-enyl)-2-oxooxolan-3-ylidene]-11-(5-oxo-2H-furan-3-yl)undeca-4,8-dien-3-yl] acetate |
|---|---|
| PubChem CID | 162931870 |
| Molecular Formula | C27H36O6 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | [(1Z,3R,4E,8E)-4,8-dimethyl-1-[(5R)-5-(2-methylprop-1-enyl)-2-oxooxolan-3-ylidene]-11-(5-oxo-2H-furan-3-yl)undeca-4,8-dien-3-yl] acetate |
| SMILES | CC(=O)O[C@H](C/C=C1/C[C@H](C=C(C)C)OC1=O)/C(C)=C/CC/C(C)=C/CCC1=CC(=O)OC1 |
| InChI | InChI=1S/C27H36O6/c1-18(2)14-24-16-23(27(30)33-24)12-13-25(32-21(5)28)20(4)10-6-8-19(3)9-7-11-22-15-26(29)31-17-22/h9-10,12,14-15,24-25H,6-8,11,13,16-17H2,1-5H3/b19-9+,20-10+,23-12-/t24-,25+/m0/s1 |
| InChIKey | SAORVJUYIMHNGG-PRBGZQACSA-N |
| XLogP | 5.45 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|