C37H47NO11 — CID 162932152
[4,10,12,16-tetrahydroxy-9-(hydroxymethyl)-3,7,11,13,15,17,21-heptamethyl-6,22,26,28-tetraoxo-23-azatricyclo[22.3.1.05,27]octacosa-1(27),2,4,7,18,20,24-heptaen-14-yl] acetate (PubChem CID 162932152) has the molecular formula C37H47NO11 and a molecular weight of 681.78 g/mol. Its IUPAC name is [4,10,12,16-tetrahydroxy-9-(hydroxymethyl)-3,7,11,13,15,17,21-heptamethyl-6,22,26,28-tetraoxo-23-azatricyclo[22.3.1.05,27]octacosa-1(27),2,4,7,18,20,24-heptaen-14-yl] acetate.
| Compound Name | [4,10,12,16-tetrahydroxy-9-(hydroxymethyl)-3,7,11,13,15,17,21-heptamethyl-6,22,26,28-tetraoxo-23-azatricyclo[22.3.1.05,27]octacosa-1(27),2,4,7,18,20,24-heptaen-14-yl] acetate |
|---|---|
| PubChem CID | 162932152 |
| Molecular Formula | C37H47NO11 |
| Molecular Weight | 681.78 g/mol |
| Exact Mass | 681.31 |
| IUPAC Name | [4,10,12,16-tetrahydroxy-9-(hydroxymethyl)-3,7,11,13,15,17,21-heptamethyl-6,22,26,28-tetraoxo-23-azatricyclo[22.3.1.05,27]octacosa-1(27),2,4,7,18,20,24-heptaen-14-yl] acetate |
| SMILES | CC(=O)OC1C(C)C(O)C(C)C=CC=C(C)C(=O)NC2=CC(=O)c3c(cc(C)c(O)c3C(=O)C(C)=CC(CO)C(O)C(C)C(O)C1C)C2=O |
| InChI | InChI=1S/C37H47NO11/c1-16-10-9-11-17(2)37(48)38-26-14-27(41)28-25(35(26)47)13-19(4)32(44)29(28)31(43)18(3)12-24(15-39)34(46)20(5)33(45)22(7)36(49-23(8)40)21(6)30(16)42/h9-14,16,20-22,24,30,33-34,36,39,42,44-46H,15H2,1-8H3,(H,38,48) |
| InChIKey | UBHFDXQXWUXBOO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 207.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.78 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|