C20H22O5 — CID 162932416
(2S,4R)-4-ethenyl-2-hydroxy-2-[(1R)-1-hydroxy-2-methylprop-2-enyl]-4,10-dimethyl-3H-pyrano[3,2-c]chromen-5-one (PubChem CID 162932416) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is (2S,4R)-4-ethenyl-2-hydroxy-2-[(1R)-1-hydroxy-2-methylprop-2-enyl]-4,10-dimethyl-3H-pyrano[3,2-c]chromen-5-one.
| Compound Name | (2S,4R)-4-ethenyl-2-hydroxy-2-[(1R)-1-hydroxy-2-methylprop-2-enyl]-4,10-dimethyl-3H-pyrano[3,2-c]chromen-5-one |
|---|---|
| PubChem CID | 162932416 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (2S,4R)-4-ethenyl-2-hydroxy-2-[(1R)-1-hydroxy-2-methylprop-2-enyl]-4,10-dimethyl-3H-pyrano[3,2-c]chromen-5-one |
| SMILES | C=C[C@@]1(C)C[C@@](O)([C@H](O)C(=C)C)Oc2c1c(=O)oc1cccc(C)c21 |
| InChI | InChI=1S/C20H22O5/c1-6-19(5)10-20(23,17(21)11(2)3)25-16-14-12(4)8-7-9-13(14)24-18(22)15(16)19/h6-9,17,21,23H,1-2,10H2,3-5H3/t17-,19+,20+/m1/s1 |
| InChIKey | LJPDNHJFYBWMCF-HOJAQTOUSA-N |
| XLogP | 2.95 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|