C20H28O3 — CID 162932667
1-[(4aS,5S,6R)-6-methoxy-3,4a,5-trimethyl-4,5,7,9-tetrahydrobenzo[f][1]benzofuran-6-yl]butan-1-one (PubChem CID 162932667) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 1-[(4aS,5S,6R)-6-methoxy-3,4a,5-trimethyl-4,5,7,9-tetrahydrobenzo[f][1]benzofuran-6-yl]butan-1-one.
| Compound Name | 1-[(4aS,5S,6R)-6-methoxy-3,4a,5-trimethyl-4,5,7,9-tetrahydrobenzo[f][1]benzofuran-6-yl]butan-1-one |
|---|---|
| PubChem CID | 162932667 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 1-[(4aS,5S,6R)-6-methoxy-3,4a,5-trimethyl-4,5,7,9-tetrahydrobenzo[f][1]benzofuran-6-yl]butan-1-one |
| SMILES | CCCC(=O)[C@@]1(OC)CC=C2Cc3occ(C)c3C[C@@]2(C)[C@@H]1C |
| InChI | InChI=1S/C20H28O3/c1-6-7-18(21)20(22-5)9-8-15-10-17-16(13(2)12-23-17)11-19(15,4)14(20)3/h8,12,14H,6-7,9-11H2,1-5H3/t14-,19-,20+/m0/s1 |
| InChIKey | YGNZLKUAAUAELR-PNHOKKKMSA-N |
| XLogP | 4.41 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|