C27H36O5 — CID 162932728
(1S,9R,10R,11R,12R,14R,16S)-5,7-dihydroxy-10,13,13,16-tetramethyl-9-(2-methylpropyl)-2-oxapentacyclo[8.6.2.01,11.03,8.012,14]octadeca-3,5,7-triene-4,6-dicarbaldehyde (PubChem CID 162932728) has the molecular formula C27H36O5 and a molecular weight of 440.58 g/mol. Its IUPAC name is (1S,9R,10R,11R,12R,14R,16S)-5,7-dihydroxy-10,13,13,16-tetramethyl-9-(2-methylpropyl)-2-oxapentacyclo[8.6.2.01,11.03,8.012,14]octadeca-3,5,7-triene-4,6-dicarbaldehyde.
| Compound Name | (1S,9R,10R,11R,12R,14R,16S)-5,7-dihydroxy-10,13,13,16-tetramethyl-9-(2-methylpropyl)-2-oxapentacyclo[8.6.2.01,11.03,8.012,14]octadeca-3,5,7-triene-4,6-dicarbaldehyde |
|---|---|
| PubChem CID | 162932728 |
| Molecular Formula | C27H36O5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | (1S,9R,10R,11R,12R,14R,16S)-5,7-dihydroxy-10,13,13,16-tetramethyl-9-(2-methylpropyl)-2-oxapentacyclo[8.6.2.01,11.03,8.012,14]octadeca-3,5,7-triene-4,6-dicarbaldehyde |
| SMILES | CC(C)C[C@H]1c2c(O)c(C=O)c(O)c(C=O)c2O[C@]23CC[C@@]1(C)[C@H]2[C@H]1[C@@H](C[C@@H]3C)C1(C)C |
| InChI | InChI=1S/C27H36O5/c1-13(2)9-17-19-22(31)15(11-28)21(30)16(12-29)23(19)32-27-8-7-26(17,6)24(27)20-18(10-14(27)3)25(20,4)5/h11-14,17-18,20,24,30-31H,7-10H2,1-6H3/t14-,17-,18+,20+,24+,26+,27-/m0/s1 |
| InChIKey | OZWKDZYKDNCTPT-AZVSDANLSA-N |
| XLogP | 5.71 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|