C25H38O4 — CID 162933010
3-[(1R)-1-hydroxy-4-(hydroxymethyl)-8,12,16-trimethylheptadeca-3,7,11,15-tetraenyl]-2H-furan-5-one (PubChem CID 162933010) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is 3-[(1R)-1-hydroxy-4-(hydroxymethyl)-8,12,16-trimethylheptadeca-3,7,11,15-tetraenyl]-2H-furan-5-one.
| Compound Name | 3-[(1R)-1-hydroxy-4-(hydroxymethyl)-8,12,16-trimethylheptadeca-3,7,11,15-tetraenyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 162933010 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 3-[(1R)-1-hydroxy-4-(hydroxymethyl)-8,12,16-trimethylheptadeca-3,7,11,15-tetraenyl]-2H-furan-5-one |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(=CC[C@@H](O)C1=CC(=O)OC1)CO |
| InChI | InChI=1S/C25H38O4/c1-19(2)8-5-9-20(3)10-6-11-21(4)12-7-13-22(17-26)14-15-24(27)23-16-25(28)29-18-23/h8,10,12,14,16,24,26-27H,5-7,9,11,13,15,17-18H2,1-4H3/t24-/m1/s1 |
| InChIKey | VILQISSGAQMQCL-XMMPIXPASA-N |
| XLogP | 5.34 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|