C22H28O6 — CID 162933028
10-butyl-9-pentyl-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone (PubChem CID 162933028) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is 10-butyl-9-pentyl-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone.
| Compound Name | 10-butyl-9-pentyl-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone |
|---|---|
| PubChem CID | 162933028 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 10-butyl-9-pentyl-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone |
| SMILES | CCCCCC1C2=C(CCC3=C(CC1CCCC)C(=O)OC3=O)C(=O)OC2=O |
| InChI | InChI=1S/C22H28O6/c1-3-5-7-9-14-13(8-6-4-2)12-17-15(19(23)27-21(17)25)10-11-16-18(14)22(26)28-20(16)24/h13-14H,3-12H2,1-2H3 |
| InChIKey | LCWOOBCFNMICPG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|