C41H56O4 — CID 162933317
6-hydroxy-3-(24-hydroxy-23-methoxy-3,7,12,16,20,24-hexamethylpentacosa-1,3,5,7,9,11,13,15,17,19,21-undecaenyl)-2,4,4-trimethylcyclohex-2-en-1-one (PubChem CID 162933317) has the molecular formula C41H56O4 and a molecular weight of 612.90 g/mol. Its IUPAC name is 6-hydroxy-3-(24-hydroxy-23-methoxy-3,7,12,16,20,24-hexamethylpentacosa-1,3,5,7,9,11,13,15,17,19,21-undecaenyl)-2,4,4-trimethylcyclohex-2-en-1-one.
| Compound Name | 6-hydroxy-3-(24-hydroxy-23-methoxy-3,7,12,16,20,24-hexamethylpentacosa-1,3,5,7,9,11,13,15,17,19,21-undecaenyl)-2,4,4-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 162933317 |
| Molecular Formula | C41H56O4 |
| Molecular Weight | 612.90 g/mol |
| Exact Mass | 612.42 |
| IUPAC Name | 6-hydroxy-3-(24-hydroxy-23-methoxy-3,7,12,16,20,24-hexamethylpentacosa-1,3,5,7,9,11,13,15,17,19,21-undecaenyl)-2,4,4-trimethylcyclohex-2-en-1-one |
| SMILES | COC(C=CC(C)=CC=CC(C)=CC=CC(C)=CC=CC=C(C)C=CC=C(C)C=CC1=C(C)C(=O)C(O)CC1(C)C)C(C)(C)O |
| InChI | InChI=1S/C41H56O4/c1-30(19-14-21-32(3)22-16-24-34(5)26-28-38(45-11)41(9,10)44)17-12-13-18-31(2)20-15-23-33(4)25-27-36-35(6)39(43)37(42)29-40(36,7)8/h12-28,37-38,42,44H,29H2,1-11H3 |
| InChIKey | AXNMZTXBDMIOQI-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.90 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|