benzhydryl 3,3-dimethylaziridine-2-carboxylate

C18H19NO2 — CID 162933415

IUPACbenzhydryl 3,3-dimethylaziridine-2-carboxylate
SMILESCC1(C)NC1C(=O)OC(c1ccccc1)c1ccccc1
InChIInChI=1S/C18H19NO2/c1-18(2)16(19-18)17(20)21-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15-16,19H,1-2H3
InChIKeyUMOVBYPSVYYGQT-UHFFFAOYSA-N
MW281.36 g/mol
LogP3.07
Rot. Bonds4

About benzhydryl 3,3-dimethylaziridine-2-carboxylate

benzhydryl 3,3-dimethylaziridine-2-carboxylate (PubChem CID 162933415) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is benzhydryl 3,3-dimethylaziridine-2-carboxylate.

Molecular Properties

Compound Namebenzhydryl 3,3-dimethylaziridine-2-carboxylate
PubChem CID162933415
Molecular FormulaC18H19NO2
Molecular Weight281.36 g/mol
Exact Mass281.14
IUPAC Namebenzhydryl 3,3-dimethylaziridine-2-carboxylate
SMILESCC1(C)NC1C(=O)OC(c1ccccc1)c1ccccc1
InChIInChI=1S/C18H19NO2/c1-18(2)16(19-18)17(20)21-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15-16,19H,1-2H3
InChIKeyUMOVBYPSVYYGQT-UHFFFAOYSA-N
XLogP3.07
TPSA48.24 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.36
LogP ≤ 53.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}

Analyze benzhydryl 3,3-dimethylaziridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzhydryl 3,3-dimethylaziridine-2-carboxylate?
The IUPAC name of benzhydryl 3,3-dimethylaziridine-2-carboxylate (CID 162933415) is benzhydryl 3,3-dimethylaziridine-2-carboxylate.
What is the SMILES notation for benzhydryl 3,3-dimethylaziridine-2-carboxylate?
The canonical SMILES for benzhydryl 3,3-dimethylaziridine-2-carboxylate is CC1(C)NC1C(=O)OC(c1ccccc1)c1ccccc1.
What is the InChIKey of benzhydryl 3,3-dimethylaziridine-2-carboxylate?
The InChIKey is UMOVBYPSVYYGQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO2/c1-18(2)16(19-18)17(20)21-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15-16,19H,1-2H3.
What are the key properties of benzhydryl 3,3-dimethylaziridine-2-carboxylate?
benzhydryl 3,3-dimethylaziridine-2-carboxylate has a molecular weight of 281.36 g/mol, XLogP of 3.07, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydryl 3,3-dimethylaziridine-2-carboxylate is sourced from PubChem (CID 162933415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).