C18H19NO2 — CID 162933415
benzhydryl 3,3-dimethylaziridine-2-carboxylate (PubChem CID 162933415) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is benzhydryl 3,3-dimethylaziridine-2-carboxylate.
| Compound Name | benzhydryl 3,3-dimethylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 162933415 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | benzhydryl 3,3-dimethylaziridine-2-carboxylate |
| SMILES | CC1(C)NC1C(=O)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c1-18(2)16(19-18)17(20)21-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12,15-16,19H,1-2H3 |
| InChIKey | UMOVBYPSVYYGQT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|