C21H27NO — CID 162933434
(1R,2S,5R,6S,9S,12S,13S)-6,13-dimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icosa-7,14,17-trien-16-one (PubChem CID 162933434) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is (1R,2S,5R,6S,9S,12S,13S)-6,13-dimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icosa-7,14,17-trien-16-one.
| Compound Name | (1R,2S,5R,6S,9S,12S,13S)-6,13-dimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icosa-7,14,17-trien-16-one |
|---|---|
| PubChem CID | 162933434 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (1R,2S,5R,6S,9S,12S,13S)-6,13-dimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icosa-7,14,17-trien-16-one |
| SMILES | C[C@@H]1N=C[C@@]23CC[C@H]4[C@@H](CCC5=CC(=O)C=C[C@]54C)[C@@H]2CC[C@@H]13 |
| InChI | InChI=1S/C21H27NO/c1-13-17-5-6-19-16-4-3-14-11-15(23)7-9-20(14,2)18(16)8-10-21(17,19)12-22-13/h7,9,11-13,16-19H,3-6,8,10H2,1-2H3/t13-,16+,17-,18-,19-,20+,21+/m0/s1 |
| InChIKey | BQDQUFADQUPXAM-DLJLOSKWSA-N |
| XLogP | 4.36 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |