C16H26O4 — CID 162933645
(1R,2S,5S,8S)-2-hydroxy-8-[(E,3R,4S)-3-hydroxy-4-methylhex-1-enyl]-1,5-dimethyl-6-oxabicyclo[3.2.1]octan-3-one (PubChem CID 162933645) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is (1R,2S,5S,8S)-2-hydroxy-8-[(E,3R,4S)-3-hydroxy-4-methylhex-1-enyl]-1,5-dimethyl-6-oxabicyclo[3.2.1]octan-3-one.
| Compound Name | (1R,2S,5S,8S)-2-hydroxy-8-[(E,3R,4S)-3-hydroxy-4-methylhex-1-enyl]-1,5-dimethyl-6-oxabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 162933645 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (1R,2S,5S,8S)-2-hydroxy-8-[(E,3R,4S)-3-hydroxy-4-methylhex-1-enyl]-1,5-dimethyl-6-oxabicyclo[3.2.1]octan-3-one |
| SMILES | CC[C@H](C)[C@@H](O)/C=C/[C@H]1[C@]2(C)CO[C@@]1(C)CC(=O)[C@H]2O |
| InChI | InChI=1S/C16H26O4/c1-5-10(2)11(17)6-7-13-15(3)9-20-16(13,4)8-12(18)14(15)19/h6-7,10-11,13-14,17,19H,5,8-9H2,1-4H3/b7-6+/t10-,11-,13-,14+,15-,16-/m0/s1 |
| InChIKey | BYXLHWMYPCTLJI-UTTXFKQQSA-N |
| XLogP | 1.69 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|