About [(2S)-11-(3,5-diethyl-6-methoxy-4-oxopyran-2-yl)undecan-2-yl] acetate
[(2S)-11-(3,5-diethyl-6-methoxy-4-oxopyran-2-yl)undecan-2-yl] acetate (PubChem CID 162933652) has the molecular formula C23H38O5
and a molecular weight of 394.55 g/mol. Its IUPAC name is [(2S)-11-(3,5-diethyl-6-methoxy-4-oxopyran-2-yl)undecan-2-yl] acetate.
Molecular Properties
| Compound Name | [(2S)-11-(3,5-diethyl-6-methoxy-4-oxopyran-2-yl)undecan-2-yl] acetate |
| PubChem CID | 162933652 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | [(2S)-11-(3,5-diethyl-6-methoxy-4-oxopyran-2-yl)undecan-2-yl] acetate |
| SMILES | CCc1c(CCCCCCCCC[C@H](C)OC(C)=O)oc(OC)c(CC)c1=O |
| InChI | InChI=1S/C23H38O5/c1-6-19-21(28-23(26-5)20(7-2)22(19)25)16-14-12-10-8-9-11-13-15-17(3)27-18(4)24/h17H,6-16H2,1-5H3/t17-/m0/s1 |
| InChIKey | QRJSKZLUFINEEQ-KRWDZBQOSA-N |
| XLogP | 5.39 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-11-(3,5-diethyl-6-methoxy-4-oxopyran-2-yl)undecan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-11-(3,5-diethyl-6-methoxy-4-oxopyran-2-yl)undecan-2-yl] acetate?
The IUPAC name of [(2S)-11-(3,5-diethyl-6-methoxy-4-oxopyran-2-yl)undecan-2-yl] acetate (CID 162933652) is [(2S)-11-(3,5-diethyl-6-methoxy-4-oxopyran-2-yl)undecan-2-yl] acetate.
What is the SMILES notation for [(2S)-11-(3,5-diethyl-6-methoxy-4-oxopyran-2-yl)undecan-2-yl] acetate?
The canonical SMILES for [(2S)-11-(3,5-diethyl-6-methoxy-4-oxopyran-2-yl)undecan-2-yl] acetate is CCc1c(CCCCCCCCC[C@H](C)OC(C)=O)oc(OC)c(CC)c1=O.
What is the InChIKey of [(2S)-11-(3,5-diethyl-6-methoxy-4-oxopyran-2-yl)undecan-2-yl] acetate?
The InChIKey is QRJSKZLUFINEEQ-KRWDZBQOSA-N. The full InChI is InChI=1S/C23H38O5/c1-6-19-21(28-23(26-5)20(7-2)22(19)25)16-14-12-10-8-9-11-13-15-17(3)27-18(4)24/h17H,6-16H2,1-5H3/t17-/m0/s1.
What are the key properties of [(2S)-11-(3,5-diethyl-6-methoxy-4-oxopyran-2-yl)undecan-2-yl] acetate?
[(2S)-11-(3,5-diethyl-6-methoxy-4-oxopyran-2-yl)undecan-2-yl] acetate has a molecular weight of 394.55 g/mol, XLogP of 5.39, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-11-(3,5-diethyl-6-methoxy-4-oxopyran-2-yl)undecan-2-yl] acetate is sourced from PubChem (CID 162933652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).