C14H25NO — CID 162933696
N-(2,6,10-trimethylundeca-5,9-dienylidene)hydroxylamine (PubChem CID 162933696) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is N-(2,6,10-trimethylundeca-5,9-dienylidene)hydroxylamine.
| Compound Name | N-(2,6,10-trimethylundeca-5,9-dienylidene)hydroxylamine |
|---|---|
| PubChem CID | 162933696 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | N-(2,6,10-trimethylundeca-5,9-dienylidene)hydroxylamine |
| SMILES | CC(C)=CCCC(C)=CCCC(C)C=NO |
| InChI | InChI=1S/C14H25NO/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15-16/h7,9,11,14,16H,5-6,8,10H2,1-4H3 |
| InChIKey | KOJGBYOICHNGRF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|