C25H32O2 — CID 162933872
(5,8,8-trimethylcycloundeca-1,5,9-trien-1-yl)methyl 3-(4-methylphenyl)prop-2-enoate (PubChem CID 162933872) has the molecular formula C25H32O2 and a molecular weight of 364.53 g/mol. Its IUPAC name is (5,8,8-trimethylcycloundeca-1,5,9-trien-1-yl)methyl 3-(4-methylphenyl)prop-2-enoate.
| Compound Name | (5,8,8-trimethylcycloundeca-1,5,9-trien-1-yl)methyl 3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162933872 |
| Molecular Formula | C25H32O2 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (5,8,8-trimethylcycloundeca-1,5,9-trien-1-yl)methyl 3-(4-methylphenyl)prop-2-enoate |
| SMILES | CC1=CCC(C)(C)C=CCC(COC(=O)C=Cc2ccc(C)cc2)=CCC1 |
| InChI | InChI=1S/C25H32O2/c1-20-7-5-8-23(9-6-17-25(3,4)18-16-20)19-27-24(26)15-14-22-12-10-21(2)11-13-22/h6,8,10-17H,5,7,9,18-19H2,1-4H3 |
| InChIKey | ZWLXFBYSDMETNJ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|