C17H26O3 — CID 162933939
[(1S)-1-[(1S,3aR,7S,7aS)-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-inden-1-yl]ethyl] acetate (PubChem CID 162933939) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is [(1S)-1-[(1S,3aR,7S,7aS)-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-inden-1-yl]ethyl] acetate.
| Compound Name | [(1S)-1-[(1S,3aR,7S,7aS)-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-inden-1-yl]ethyl] acetate |
|---|---|
| PubChem CID | 162933939 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | [(1S)-1-[(1S,3aR,7S,7aS)-4-methylidene-2-oxo-7-propan-2-yl-3,3a,5,6,7,7a-hexahydro-1H-inden-1-yl]ethyl] acetate |
| SMILES | C=C1CC[C@@H](C(C)C)[C@@H]2[C@@H]([C@H](C)OC(C)=O)C(=O)C[C@@H]12 |
| InChI | InChI=1S/C17H26O3/c1-9(2)13-7-6-10(3)14-8-15(19)16(17(13)14)11(4)20-12(5)18/h9,11,13-14,16-17H,3,6-8H2,1-2,4-5H3/t11-,13-,14-,16-,17-/m0/s1 |
| InChIKey | LXZVWWAMUYQSIZ-LLLJDESDSA-N |
| XLogP | 3.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|