C10H18O3 — CID 162933951
(3R,4S,5S)-3,7-dimethylocta-1,6-diene-3,4,5-triol (PubChem CID 162933951) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (3R,4S,5S)-3,7-dimethylocta-1,6-diene-3,4,5-triol.
| Compound Name | (3R,4S,5S)-3,7-dimethylocta-1,6-diene-3,4,5-triol |
|---|---|
| PubChem CID | 162933951 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (3R,4S,5S)-3,7-dimethylocta-1,6-diene-3,4,5-triol |
| SMILES | C=C[C@@](C)(O)[C@@H](O)[C@@H](O)C=C(C)C |
| InChI | InChI=1S/C10H18O3/c1-5-10(4,13)9(12)8(11)6-7(2)3/h5-6,8-9,11-13H,1H2,2-4H3/t8-,9-,10+/m0/s1 |
| InChIKey | UBKAPFPNNLGJBH-LPEHRKFASA-N |
| XLogP | 0.61 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|