C22H30O5 — CID 162933971
[(2R,3S,4R,4aR,8aR)-3,4,8,8a-tetramethyl-6-oxo-4-[2-(5-oxo-2H-furan-3-yl)ethyl]-2,3,4a,5-tetrahydro-1H-naphthalen-2-yl] acetate (PubChem CID 162933971) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is [(2R,3S,4R,4aR,8aR)-3,4,8,8a-tetramethyl-6-oxo-4-[2-(5-oxo-2H-furan-3-yl)ethyl]-2,3,4a,5-tetrahydro-1H-naphthalen-2-yl] acetate.
| Compound Name | [(2R,3S,4R,4aR,8aR)-3,4,8,8a-tetramethyl-6-oxo-4-[2-(5-oxo-2H-furan-3-yl)ethyl]-2,3,4a,5-tetrahydro-1H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 162933971 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | [(2R,3S,4R,4aR,8aR)-3,4,8,8a-tetramethyl-6-oxo-4-[2-(5-oxo-2H-furan-3-yl)ethyl]-2,3,4a,5-tetrahydro-1H-naphthalen-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@]2(C)C(C)=CC(=O)C[C@@H]2[C@@](C)(CCC2=CC(=O)OC2)[C@@H]1C |
| InChI | InChI=1S/C22H30O5/c1-13-8-17(24)10-19-21(4,7-6-16-9-20(25)26-12-16)14(2)18(27-15(3)23)11-22(13,19)5/h8-9,14,18-19H,6-7,10-12H2,1-5H3/t14-,18-,19-,21+,22+/m1/s1 |
| InChIKey | MSVYSHCEMUVDJI-HRLOXLBDSA-N |
| XLogP | 3.77 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |