C15H30O2 — CID 162934688
(2S,4R,10S)-2,10-dimethyl-6-methylidenedodecane-1,4-diol (PubChem CID 162934688) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is (2S,4R,10S)-2,10-dimethyl-6-methylidenedodecane-1,4-diol.
| Compound Name | (2S,4R,10S)-2,10-dimethyl-6-methylidenedodecane-1,4-diol |
|---|---|
| PubChem CID | 162934688 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | (2S,4R,10S)-2,10-dimethyl-6-methylidenedodecane-1,4-diol |
| SMILES | C=C(CCC[C@@H](C)CC)C[C@H](O)C[C@H](C)CO |
| InChI | InChI=1S/C15H30O2/c1-5-12(2)7-6-8-13(3)9-15(17)10-14(4)11-16/h12,14-17H,3,5-11H2,1-2,4H3/t12-,14-,15-/m0/s1 |
| InChIKey | VBYQXYSSKALZIL-QEJZJMRPSA-N |
| XLogP | 3.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|