C15H20O — CID 162935038
(1S,2S,5R)-1,2,5-trimethyl-2-(4-methylphenyl)-6-oxabicyclo[3.1.0]hexane (PubChem CID 162935038) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is (1S,2S,5R)-1,2,5-trimethyl-2-(4-methylphenyl)-6-oxabicyclo[3.1.0]hexane.
| Compound Name | (1S,2S,5R)-1,2,5-trimethyl-2-(4-methylphenyl)-6-oxabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 162935038 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (1S,2S,5R)-1,2,5-trimethyl-2-(4-methylphenyl)-6-oxabicyclo[3.1.0]hexane |
| SMILES | Cc1ccc([C@]2(C)CC[C@@]3(C)O[C@]32C)cc1 |
| InChI | InChI=1S/C15H20O/c1-11-5-7-12(8-6-11)13(2)9-10-14(3)15(13,4)16-14/h5-8H,9-10H2,1-4H3/t13-,14+,15-/m0/s1 |
| InChIKey | KACIPUBUINXLKX-ZNMIVQPWSA-N |
| XLogP | 3.59 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|