C20H26O3 — CID 162935241
(1R,5R,7R,8S,9R,14R)-12-hydroxy-3,7,11,14-tetramethyltetracyclo[6.5.3.01,9.05,9]hexadeca-3,11-diene-10,13-dione (PubChem CID 162935241) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (1R,5R,7R,8S,9R,14R)-12-hydroxy-3,7,11,14-tetramethyltetracyclo[6.5.3.01,9.05,9]hexadeca-3,11-diene-10,13-dione.
| Compound Name | (1R,5R,7R,8S,9R,14R)-12-hydroxy-3,7,11,14-tetramethyltetracyclo[6.5.3.01,9.05,9]hexadeca-3,11-diene-10,13-dione |
|---|---|
| PubChem CID | 162935241 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (1R,5R,7R,8S,9R,14R)-12-hydroxy-3,7,11,14-tetramethyltetracyclo[6.5.3.01,9.05,9]hexadeca-3,11-diene-10,13-dione |
| SMILES | CC1=C[C@H]2C[C@@H](C)[C@@H]3CC[C@@H](C)[C@@]4(C1)C(=O)C(O)=C(C)C(=O)[C@@]234 |
| InChI | InChI=1S/C20H26O3/c1-10-7-14-8-11(2)15-6-5-12(3)19(9-10)18(23)16(21)13(4)17(22)20(14,15)19/h7,11-12,14-15,21H,5-6,8-9H2,1-4H3/t11-,12-,14+,15+,19+,20-/m1/s1 |
| InChIKey | CGNQDBPLJCEZON-LLJSYDRYSA-N |
| XLogP | 4.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|